C23H29F2N3O4 — CID 171541295
(3-propan-2-ylcyclobutyl)methyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate (PubChem CID 171541295) has the molecular formula C23H29F2N3O4 and a molecular weight of 449.50 g/mol. Its IUPAC name is (3-propan-2-ylcyclobutyl)methyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate.
| Compound Name | (3-propan-2-ylcyclobutyl)methyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171541295 |
| Molecular Formula | C23H29F2N3O4 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | (3-propan-2-ylcyclobutyl)methyl N-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]carbamate |
| SMILES | CC(C)C1CC(COC(=O)NC2CN(c3cc(F)c(C4CCC(=O)NC4=O)c(F)c3)C2)C1 |
| InChI | InChI=1S/C23H29F2N3O4/c1-12(2)14-5-13(6-14)11-32-23(31)26-15-9-28(10-15)16-7-18(24)21(19(25)8-16)17-3-4-20(29)27-22(17)30/h7-8,12-15,17H,3-6,9-11H2,1-2H3,(H,26,31)(H,27,29,30) |
| InChIKey | LDASKYZEBXOOQS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|