C21H43NO8 — CID 171541577
hexane-1,2-diol;5-methyl-1-[2-[2-[2-(2-nitrosoethoxy)ethoxy]ethoxy]ethoxy]hexan-3-one (PubChem CID 171541577) has the molecular formula C21H43NO8 and a molecular weight of 437.57 g/mol. Its IUPAC name is hexane-1,2-diol;5-methyl-1-[2-[2-[2-(2-nitrosoethoxy)ethoxy]ethoxy]ethoxy]hexan-3-one.
| Compound Name | hexane-1,2-diol;5-methyl-1-[2-[2-[2-(2-nitrosoethoxy)ethoxy]ethoxy]ethoxy]hexan-3-one |
|---|---|
| PubChem CID | 171541577 |
| Molecular Formula | C21H43NO8 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | hexane-1,2-diol;5-methyl-1-[2-[2-[2-(2-nitrosoethoxy)ethoxy]ethoxy]ethoxy]hexan-3-one |
| SMILES | CC(C)CC(=O)CCOCCOCCOCCOCCN=O.CCCCC(O)CO |
| InChI | InChI=1S/C15H29NO6.C6H14O2/c1-14(2)13-15(17)3-5-19-7-9-21-11-12-22-10-8-20-6-4-16-18;1-2-3-4-6(8)5-7/h14H,3-13H2,1-2H3;6-8H,2-5H2,1H3 |
| InChIKey | AMPWDOXNYMAOCO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|