C27H55NO15 — CID 171541647
3-[2-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal (PubChem CID 171541647) has the molecular formula C27H55NO15 and a molecular weight of 633.73 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal.
| Compound Name | 3-[2-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal |
|---|---|
| PubChem CID | 171541647 |
| Molecular Formula | C27H55NO15 |
| Molecular Weight | 633.73 g/mol |
| Exact Mass | 633.36 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[2-[bis(2,3,4,6-tetrahydroxyhexyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanal |
| SMILES | O=CCCOCCOCCOCCOCCOCCOCCN(CC(O)C(O)C(O)CCO)CC(O)C(O)C(O)CCO |
| InChI | InChI=1S/C27H55NO15/c29-5-1-8-38-10-12-40-14-16-42-18-19-43-17-15-41-13-11-39-9-4-28(20-24(34)26(36)22(32)2-6-30)21-25(35)27(37)23(33)3-7-31/h5,22-27,30-37H,1-4,6-21H2 |
| InChIKey | PKKSVHKUAWQGBD-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 237.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.73 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|