C27H39N3OSSn — CID 171542113
(15R)-15-methyl-5-tributylstannyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 171542113) has the molecular formula C27H39N3OSSn and a molecular weight of 572.41 g/mol. Its IUPAC name is (15R)-15-methyl-5-tributylstannyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-15-methyl-5-tributylstannyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 171542113 |
| Molecular Formula | C27H39N3OSSn |
| Molecular Weight | 572.41 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | (15R)-15-methyl-5-tributylstannyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2c(ccc3sc4c(c32)NC[C@@H](C)NC4=O)n1 |
| InChI | InChI=1S/C15H12N3OS.3C4H9.Sn/c1-8-7-17-13-12-9-3-2-6-16-10(9)4-5-11(12)20-14(13)15(19)18-8;3*1-3-4-2;/h2-5,8,17H,7H2,1H3,(H,18,19);3*1,3-4H2,2H3;/t8-;;;;/m1..../s1 |
| InChIKey | PTXXBFODIKYIBP-XWCOYVICSA-N |
| XLogP | 7.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.41 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |