C22H16N4OS — CID 171542335
(15R)-5-(2-ethynyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 171542335) has the molecular formula C22H16N4OS and a molecular weight of 384.46 g/mol. Its IUPAC name is (15R)-5-(2-ethynyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-5-(2-ethynyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 171542335 |
| Molecular Formula | C22H16N4OS |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (15R)-5-(2-ethynyl-4-pyridinyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | C#Cc1cc(-c2ccc3c(ccc4sc5c(c43)NC[C@@H](C)NC5=O)n2)ccn1 |
| InChI | InChI=1S/C22H16N4OS/c1-3-14-10-13(8-9-23-14)16-5-4-15-17(26-16)6-7-18-19(15)20-21(28-18)22(27)25-12(2)11-24-20/h1,4-10,12,24H,11H2,2H3,(H,25,27)/t12-/m1/s1 |
| InChIKey | JWDHKFRHTPOZEQ-GFCCVEGCSA-N |
| XLogP | 4.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|