C10H12F2N2S — CID 171542517
5-aminosulfanyl-2,3-difluorobenzonitrile;propane (PubChem CID 171542517) has the molecular formula C10H12F2N2S and a molecular weight of 230.28 g/mol. Its IUPAC name is 5-aminosulfanyl-2,3-difluorobenzonitrile;propane.
| Compound Name | 5-aminosulfanyl-2,3-difluorobenzonitrile;propane |
|---|---|
| PubChem CID | 171542517 |
| Molecular Formula | C10H12F2N2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-aminosulfanyl-2,3-difluorobenzonitrile;propane |
| SMILES | CCC.N#Cc1cc(SN)cc(F)c1F |
| InChI | InChI=1S/C7H4F2N2S.C3H8/c8-6-2-5(12-11)1-4(3-10)7(6)9;1-3-2/h1-2H,11H2;3H2,1-2H3 |
| InChIKey | SKDHEAMNGHIVHR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|