C31H38F4N4O2S2 — CID 171543234
N-(4-amino-3-cyano-5-fluorophenyl)sulfanyl-1-methoxycyclohexane-1-carboxamide;6,6-difluoro-2-[4-(4-fluorophenyl)sulfanylbutyl]-2-azaspiro[3.3]heptane (PubChem CID 171543234) has the molecular formula C31H38F4N4O2S2 and a molecular weight of 638.80 g/mol. Its IUPAC name is N-(4-amino-3-cyano-5-fluorophenyl)sulfanyl-1-methoxycyclohexane-1-carboxamide;6,6-difluoro-2-[4-(4-fluorophenyl)sulfanylbutyl]-2-azaspiro[3.3]heptane.
| Compound Name | N-(4-amino-3-cyano-5-fluorophenyl)sulfanyl-1-methoxycyclohexane-1-carboxamide;6,6-difluoro-2-[4-(4-fluorophenyl)sulfanylbutyl]-2-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 171543234 |
| Molecular Formula | C31H38F4N4O2S2 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | N-(4-amino-3-cyano-5-fluorophenyl)sulfanyl-1-methoxycyclohexane-1-carboxamide;6,6-difluoro-2-[4-(4-fluorophenyl)sulfanylbutyl]-2-azaspiro[3.3]heptane |
| SMILES | COC1(C(=O)NSc2cc(F)c(N)c(C#N)c2)CCCCC1.Fc1ccc(SCCCCN2CC3(C2)CC(F)(F)C3)cc1 |
| InChI | InChI=1S/C16H20F3NS.C15H18FN3O2S/c17-13-3-5-14(6-4-13)21-8-2-1-7-20-11-15(12-20)9-16(18,19)10-15;1-21-15(5-3-2-4-6-15)14(20)19-22-11-7-10(9-17)13(18)12(16)8-11/h3-6H,1-2,7-12H2;7-8H,2-6,18H2,1H3,(H,19,20) |
| InChIKey | LGODHXHZQIZHOY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|