C28H45N3 — CID 171543528
1-ethylcyclohepta-1,3,5-triene;N-ethylcyclopentanamine;(3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine (PubChem CID 171543528) has the molecular formula C28H45N3 and a molecular weight of 423.69 g/mol. Its IUPAC name is 1-ethylcyclohepta-1,3,5-triene;N-ethylcyclopentanamine;(3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine.
| Compound Name | 1-ethylcyclohepta-1,3,5-triene;N-ethylcyclopentanamine;(3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 171543528 |
| Molecular Formula | C28H45N3 |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 423.36 |
| IUPAC Name | 1-ethylcyclohepta-1,3,5-triene;N-ethylcyclopentanamine;(3E,5Z)-N-(methylideneamino)-N-(2-methylprop-1-enyl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C=C/C)N(C=C(C)C)N=C.CCC1=CC=CC=CC1.CCNC1CCCC1 |
| InChI | InChI=1S/C12H18N2.C9H12.C7H15N/c1-6-8-9-12(7-2)14(13-5)10-11(3)4;1-2-9-7-5-3-4-6-8-9;1-2-8-7-5-3-4-6-7/h6-10H,2,5H2,1,3-4H3;3-7H,2,8H2,1H3;7-8H,2-6H2,1H3/b8-6-,12-9+;; |
| InChIKey | NHSBWVLWPNJBRV-JMLAAAMTSA-N |
| XLogP | 7.85 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|