C14H25N3 — CID 171544275
ethane;1-methyl-3-propan-2-ylpyrazolo[5,4-b]pyridine (PubChem CID 171544275) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is ethane;1-methyl-3-propan-2-ylpyrazolo[5,4-b]pyridine.
| Compound Name | ethane;1-methyl-3-propan-2-ylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 171544275 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | ethane;1-methyl-3-propan-2-ylpyrazolo[5,4-b]pyridine |
| SMILES | CC.CC.CC(C)c1nn(C)c2ncccc12 |
| InChI | InChI=1S/C10H13N3.2C2H6/c1-7(2)9-8-5-4-6-11-10(8)13(3)12-9;2*1-2/h4-7H,1-3H3;2*1-2H3 |
| InChIKey | XRVOCWLUTPTPMW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |