About 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide
3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide (PubChem CID 171544892) has the molecular formula C13H10ClF2NO4S2
and a molecular weight of 381.81 g/mol. Its IUPAC name is 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide |
| PubChem CID | 171544892 |
| Molecular Formula | C13H10ClF2NO4S2 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)N(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C13H10ClF2NO4S2/c1-9-2-4-10(5-3-9)22(18,19)13-7-6-11(8-12(13)14)23(20,21)17(15)16/h2-8H,1H3 |
| InChIKey | BWGBZZWURFSLPN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide?
The IUPAC name of 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide (CID 171544892) is 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide.
What is the SMILES notation for 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide?
The canonical SMILES for 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide is Cc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)N(F)F)cc2Cl)cc1.
What is the InChIKey of 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide?
The InChIKey is BWGBZZWURFSLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClF2NO4S2/c1-9-2-4-10(5-3-9)22(18,19)13-7-6-11(8-12(13)14)23(20,21)17(15)16/h2-8H,1H3.
What are the key properties of 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide?
3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide has a molecular weight of 381.81 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-difluoro-4-(4-methylphenyl)sulfonylbenzenesulfonamide is sourced from PubChem (CID 171544892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).