About 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane]
5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] (PubChem CID 171545165) has the molecular formula C10H10FNO
and a molecular weight of 179.19 g/mol. Its IUPAC name is 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane].
Molecular Properties
| Compound Name | 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] |
| PubChem CID | 171545165 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] |
| SMILES | Fc1ccc2c(c1)C1(CCO1)CN2 |
| InChI | InChI=1S/C10H10FNO/c11-7-1-2-9-8(5-7)10(6-12-9)3-4-13-10/h1-2,5,12H,3-4,6H2 |
| InChIKey | HXYMURNJZRBXGK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane]?
The IUPAC name of 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] (CID 171545165) is 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane].
What is the SMILES notation for 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane]?
The canonical SMILES for 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] is Fc1ccc2c(c1)C1(CCO1)CN2.
What is the InChIKey of 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane]?
The InChIKey is HXYMURNJZRBXGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO/c11-7-1-2-9-8(5-7)10(6-12-9)3-4-13-10/h1-2,5,12H,3-4,6H2.
What are the key properties of 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane]?
5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] has a molecular weight of 179.19 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluorospiro[1,2-dihydroindole-3,2'-oxetane] is sourced from PubChem (CID 171545165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).