C32H19N5O3S — CID 171545448
12-(4-dibenzofuran-4-ylphenyl)-2λ6-thia-1,3,10,12,14-pentazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-4,6,8,10,13,15,17,19-octaene 2,2-dioxide (PubChem CID 171545448) has the molecular formula C32H19N5O3S and a molecular weight of 553.60 g/mol. Its IUPAC name is 12-(4-dibenzofuran-4-ylphenyl)-2λ6-thia-1,3,10,12,14-pentazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-4,6,8,10,13,15,17,19-octaene 2,2-dioxide.
| Compound Name | 12-(4-dibenzofuran-4-ylphenyl)-2λ6-thia-1,3,10,12,14-pentazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-4,6,8,10,13,15,17,19-octaene 2,2-dioxide |
|---|---|
| PubChem CID | 171545448 |
| Molecular Formula | C32H19N5O3S |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 12-(4-dibenzofuran-4-ylphenyl)-2λ6-thia-1,3,10,12,14-pentazapentacyclo[11.7.0.03,11.04,9.015,20]icosa-4,6,8,10,13,15,17,19-octaene 2,2-dioxide |
| SMILES | O=S1(=O)n2c(nc3ccccc32)N(c2ccc(-c3cccc4c3oc3ccccc34)cc2)c2nc3ccccc3n21 |
| InChI | InChI=1S/C32H19N5O3S/c38-41(39)36-27-13-4-2-11-25(27)33-31(36)35(32-34-26-12-3-5-14-28(26)37(32)41)21-18-16-20(17-19-21)22-9-7-10-24-23-8-1-6-15-29(23)40-30(22)24/h1-19H |
| InChIKey | SEZFIUGRMSQKAB-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |