About (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate
(6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate (PubChem CID 171546442) has the molecular formula C10H8F3N3O4S2
and a molecular weight of 355.32 g/mol. Its IUPAC name is (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate |
| PubChem CID | 171546442 |
| Molecular Formula | C10H8F3N3O4S2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate |
| SMILES | CSc1ncc2c(OS(=O)(=O)C(F)(F)F)c(C)c(=O)[nH]c2n1 |
| InChI | InChI=1S/C10H8F3N3O4S2/c1-4-6(20-22(18,19)10(11,12)13)5-3-14-9(21-2)16-7(5)15-8(4)17/h3H,1-2H3,(H,14,15,16,17) |
| InChIKey | JPWRFZBHLATILT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate?
The IUPAC name of (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate (CID 171546442) is (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate.
What is the SMILES notation for (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate?
The canonical SMILES for (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate is CSc1ncc2c(OS(=O)(=O)C(F)(F)F)c(C)c(=O)[nH]c2n1.
What is the InChIKey of (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate?
The InChIKey is JPWRFZBHLATILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3O4S2/c1-4-6(20-22(18,19)10(11,12)13)5-3-14-9(21-2)16-7(5)15-8(4)17/h3H,1-2H3,(H,14,15,16,17).
What are the key properties of (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate?
(6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate has a molecular weight of 355.32 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-2-methylsulfanyl-7-oxo-8H-pyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate is sourced from PubChem (CID 171546442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).