C16H12F3N3O4S2 — CID 171546771
(8-methyl-2-methylsulfanyl-7-oxo-6-phenylpyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate (PubChem CID 171546771) has the molecular formula C16H12F3N3O4S2 and a molecular weight of 431.42 g/mol. Its IUPAC name is (8-methyl-2-methylsulfanyl-7-oxo-6-phenylpyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate.
| Compound Name | (8-methyl-2-methylsulfanyl-7-oxo-6-phenylpyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171546771 |
| Molecular Formula | C16H12F3N3O4S2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | (8-methyl-2-methylsulfanyl-7-oxo-6-phenylpyrido[2,3-d]pyrimidin-5-yl) trifluoromethanesulfonate |
| SMILES | CSc1ncc2c(OS(=O)(=O)C(F)(F)F)c(-c3ccccc3)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C16H12F3N3O4S2/c1-22-13-10(8-20-15(21-13)27-2)12(26-28(24,25)16(17,18)19)11(14(22)23)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | KRGOMLXLHSKJOQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|