C22H25N3OSSi — CID 171547425
2-methylsulfanyl-8-phenyl-5-(2-triethylsilylethynyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 171547425) has the molecular formula C22H25N3OSSi and a molecular weight of 407.62 g/mol. Its IUPAC name is 2-methylsulfanyl-8-phenyl-5-(2-triethylsilylethynyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-methylsulfanyl-8-phenyl-5-(2-triethylsilylethynyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171547425 |
| Molecular Formula | C22H25N3OSSi |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-methylsulfanyl-8-phenyl-5-(2-triethylsilylethynyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC[Si](C#Cc1cc(=O)n(-c2ccccc2)c2nc(SC)ncc12)(CC)CC |
| InChI | InChI=1S/C22H25N3OSSi/c1-5-28(6-2,7-3)14-13-17-15-20(26)25(18-11-9-8-10-12-18)21-19(17)16-23-22(24-21)27-4/h8-12,15-16H,5-7H2,1-4H3 |
| InChIKey | PZBFLLZZTUGBAO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|