About (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine
(3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine (PubChem CID 171547680) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine.
Molecular Properties
| Compound Name | (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine |
| PubChem CID | 171547680 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine |
| SMILES | C=C/C(F)=C\C(=C/C)C(C)NC |
| InChI | InChI=1S/C10H16FN/c1-5-9(8(3)12-4)7-10(11)6-2/h5-8,12H,2H2,1,3-4H3/b9-5+,10-7+ |
| InChIKey | RVWUGJQPZDPWJT-FWMCCXIMSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine?
The IUPAC name of (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine (CID 171547680) is (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine.
What is the SMILES notation for (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine?
The canonical SMILES for (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine is C=C/C(F)=C\C(=C/C)C(C)NC.
What is the InChIKey of (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine?
The InChIKey is RVWUGJQPZDPWJT-FWMCCXIMSA-N. The full InChI is InChI=1S/C10H16FN/c1-5-9(8(3)12-4)7-10(11)6-2/h5-8,12H,2H2,1,3-4H3/b9-5+,10-7+.
What are the key properties of (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine?
(3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine has a molecular weight of 169.24 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4E)-3-ethylidene-5-fluoro-N-methylhepta-4,6-dien-2-amine is sourced from PubChem (CID 171547680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).