C15H11ClF2N4S — CID 171547816
6-chloro-2-[5-(2,6-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylsulfanylpyridine (PubChem CID 171547816) has the molecular formula C15H11ClF2N4S and a molecular weight of 352.80 g/mol. Its IUPAC name is 6-chloro-2-[5-(2,6-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylsulfanylpyridine.
| Compound Name | 6-chloro-2-[5-(2,6-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylsulfanylpyridine |
|---|---|
| PubChem CID | 171547816 |
| Molecular Formula | C15H11ClF2N4S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 6-chloro-2-[5-(2,6-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylsulfanylpyridine |
| SMILES | CSc1ccc(Cl)nc1-c1nnc(-c2c(F)cccc2F)n1C |
| InChI | InChI=1S/C15H11ClF2N4S/c1-22-14(12-8(17)4-3-5-9(12)18)20-21-15(22)13-10(23-2)6-7-11(16)19-13/h3-7H,1-2H3 |
| InChIKey | POUDOFKNTBVKRM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|