About tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate
tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 171548505) has the molecular formula C18H33NO4
and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate |
| PubChem CID | 171548505 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(C(CO)CO)CC2)CC1 |
| InChI | InChI=1S/C18H33NO4/c1-17(2,3)23-16(22)19-10-8-18(9-11-19)6-4-14(5-7-18)15(12-20)13-21/h14-15,20-21H,4-13H2,1-3H3 |
| InChIKey | STDCHRYDMUUXKT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate?
The IUPAC name of tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate (CID 171548505) is tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate.
What is the SMILES notation for tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate?
The canonical SMILES for tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate is CC(C)(C)OC(=O)N1CCC2(CCC(C(CO)CO)CC2)CC1.
What is the InChIKey of tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate?
The InChIKey is STDCHRYDMUUXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO4/c1-17(2,3)23-16(22)19-10-8-18(9-11-19)6-4-14(5-7-18)15(12-20)13-21/h14-15,20-21H,4-13H2,1-3H3.
What are the key properties of tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate?
tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate has a molecular weight of 327.47 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 9-(1,3-dihydroxypropan-2-yl)-3-azaspiro[5.5]undecane-3-carboxylate is sourced from PubChem (CID 171548505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).