C19H21BrN2O3S — CID 17154923
5-bromo-2-ethoxy-N-[(3-propan-2-yloxyphenyl)carbamothioyl]benzamide (PubChem CID 17154923) has the molecular formula C19H21BrN2O3S and a molecular weight of 437.36 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[(3-propan-2-yloxyphenyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-[(3-propan-2-yloxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17154923 |
| Molecular Formula | C19H21BrN2O3S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[(3-propan-2-yloxyphenyl)carbamothioyl]benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C19H21BrN2O3S/c1-4-24-17-9-8-13(20)10-16(17)18(23)22-19(26)21-14-6-5-7-15(11-14)25-12(2)3/h5-12H,4H2,1-3H3,(H2,21,22,23,26) |
| InChIKey | WXPSDXGRRYLHCZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|