C27H22ClFN4O4 — CID 171549272
6-chloro-3-[1-[2-(6-fluoro-2-methylindazol-5-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide (PubChem CID 171549272) has the molecular formula C27H22ClFN4O4 and a molecular weight of 520.95 g/mol. Its IUPAC name is 6-chloro-3-[1-[2-(6-fluoro-2-methylindazol-5-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide.
| Compound Name | 6-chloro-3-[1-[2-(6-fluoro-2-methylindazol-5-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171549272 |
| Molecular Formula | C27H22ClFN4O4 |
| Molecular Weight | 520.95 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 6-chloro-3-[1-[2-(6-fluoro-2-methylindazol-5-yl)-3,6-dimethyl-4-oxochromen-8-yl]ethoxy]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(C)Oc2ccc(Cl)nc2C(N)=O)c2oc(-c3cc4cn(C)nc4cc3F)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H22ClFN4O4/c1-12-7-16(14(3)36-21-5-6-22(28)31-23(21)27(30)35)26-18(8-12)24(34)13(2)25(37-26)17-9-15-11-33(4)32-20(15)10-19(17)29/h5-11,14H,1-4H3,(H2,30,35) |
| InChIKey | BVSWXJGIEVOWRF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.95 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|