About 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene
5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene (PubChem CID 171549498) has the molecular formula C19H28
and a molecular weight of 256.43 g/mol. Its IUPAC name is 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene.
Molecular Properties
| Compound Name | 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene |
| PubChem CID | 171549498 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene |
| SMILES | CC(C)(C)c1cc2c(c(C3(C)CC3)c1)CCC2(C)C |
| InChI | InChI=1S/C19H28/c1-17(2,3)13-11-15-14(7-8-18(15,4)5)16(12-13)19(6)9-10-19/h11-12H,7-10H2,1-6H3 |
| InChIKey | LFUGNTLWPPESSI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene?
The IUPAC name of 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene (CID 171549498) is 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene.
What is the SMILES notation for 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene?
The canonical SMILES for 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene is CC(C)(C)c1cc2c(c(C3(C)CC3)c1)CCC2(C)C.
What is the InChIKey of 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene?
The InChIKey is LFUGNTLWPPESSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28/c1-17(2,3)13-11-15-14(7-8-18(15,4)5)16(12-13)19(6)9-10-19/h11-12H,7-10H2,1-6H3.
What are the key properties of 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene?
5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene has a molecular weight of 256.43 g/mol, XLogP of 5.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3,3-dimethyl-7-(1-methylcyclopropyl)-1,2-dihydroindene is sourced from PubChem (CID 171549498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).