C12H9BrN2OS — CID 171549551
9-bromo-6,8-dimethyl-5H-thieno[2,3-c][1,7]naphthyridin-4-one (PubChem CID 171549551) has the molecular formula C12H9BrN2OS and a molecular weight of 309.19 g/mol. Its IUPAC name is 9-bromo-6,8-dimethyl-5H-thieno[2,3-c][1,7]naphthyridin-4-one.
| Compound Name | 9-bromo-6,8-dimethyl-5H-thieno[2,3-c][1,7]naphthyridin-4-one |
|---|---|
| PubChem CID | 171549551 |
| Molecular Formula | C12H9BrN2OS |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 9-bromo-6,8-dimethyl-5H-thieno[2,3-c][1,7]naphthyridin-4-one |
| SMILES | Cc1nc(C)c2[nH]c(=O)c3sccc3c2c1Br |
| InChI | InChI=1S/C12H9BrN2OS/c1-5-9(13)8-7-3-4-17-11(7)12(16)15-10(8)6(2)14-5/h3-4H,1-2H3,(H,15,16) |
| InChIKey | FSKHYUGICGUAJP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |