About N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane
N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane (PubChem CID 171549671) has the molecular formula C16H21BrN2O2S
and a molecular weight of 385.33 g/mol. Its IUPAC name is N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane.
Molecular Properties
| Compound Name | N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane |
| PubChem CID | 171549671 |
| Molecular Formula | C16H21BrN2O2S |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane |
| SMILES | CC.COc1nc(C)c(NC=O)c(-c2cc(C)sc2C)c1Br |
| InChI | InChI=1S/C14H15BrN2O2S.C2H6/c1-7-5-10(9(3)20-7)11-12(15)14(19-4)17-8(2)13(11)16-6-18;1-2/h5-6H,1-4H3,(H,16,18);1-2H3 |
| InChIKey | PFZDNCWDLWCKSI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane?
The IUPAC name of N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane (CID 171549671) is N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane.
What is the SMILES notation for N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane?
The canonical SMILES for N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane is CC.COc1nc(C)c(NC=O)c(-c2cc(C)sc2C)c1Br.
What is the InChIKey of N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane?
The InChIKey is PFZDNCWDLWCKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2O2S.C2H6/c1-7-5-10(9(3)20-7)11-12(15)14(19-4)17-8(2)13(11)16-6-18;1-2/h5-6H,1-4H3,(H,16,18);1-2H3.
What are the key properties of N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane?
N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane has a molecular weight of 385.33 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-bromo-4-(2,5-dimethylthiophen-3-yl)-6-methoxy-2-methyl-3-pyridinyl]formamide;ethane is sourced from PubChem (CID 171549671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).