About 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one
5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one (PubChem CID 171549720) has the molecular formula C13H13BrN2OS
and a molecular weight of 325.23 g/mol. Its IUPAC name is 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one |
| PubChem CID | 171549720 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one |
| SMILES | C/C=C\Sc1cc2c(Br)c(C)nc(C)c2[nH]c1=O |
| InChI | InChI=1S/C13H13BrN2OS/c1-4-5-18-10-6-9-11(14)7(2)15-8(3)12(9)16-13(10)17/h4-6H,1-3H3,(H,16,17)/b5-4- |
| InChIKey | INSLPUYRHFUDKD-PLNGDYQASA-N |
| XLogP | 3.93 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one?
The IUPAC name of 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one (CID 171549720) is 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one.
What is the SMILES notation for 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one?
The canonical SMILES for 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one is C/C=C\Sc1cc2c(Br)c(C)nc(C)c2[nH]c1=O.
What is the InChIKey of 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one?
The InChIKey is INSLPUYRHFUDKD-PLNGDYQASA-N. The full InChI is InChI=1S/C13H13BrN2OS/c1-4-5-18-10-6-9-11(14)7(2)15-8(3)12(9)16-13(10)17/h4-6H,1-3H3,(H,16,17)/b5-4-.
What are the key properties of 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one?
5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one has a molecular weight of 325.23 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6,8-dimethyl-3-[(Z)-prop-1-enyl]sulfanyl-1H-1,7-naphthyridin-2-one is sourced from PubChem (CID 171549720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).