C20H18ClN3O2S — CID 171549969
9-[4-(1-aminopropan-2-yl)phenyl]-6-chloro-8-methoxy-5H-thieno[2,3-c][1,7]naphthyridin-4-one (PubChem CID 171549969) has the molecular formula C20H18ClN3O2S and a molecular weight of 399.90 g/mol. Its IUPAC name is 9-[4-(1-aminopropan-2-yl)phenyl]-6-chloro-8-methoxy-5H-thieno[2,3-c][1,7]naphthyridin-4-one.
| Compound Name | 9-[4-(1-aminopropan-2-yl)phenyl]-6-chloro-8-methoxy-5H-thieno[2,3-c][1,7]naphthyridin-4-one |
|---|---|
| PubChem CID | 171549969 |
| Molecular Formula | C20H18ClN3O2S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 9-[4-(1-aminopropan-2-yl)phenyl]-6-chloro-8-methoxy-5H-thieno[2,3-c][1,7]naphthyridin-4-one |
| SMILES | COc1nc(Cl)c2[nH]c(=O)c3sccc3c2c1-c1ccc(C(C)CN)cc1 |
| InChI | InChI=1S/C20H18ClN3O2S/c1-10(9-22)11-3-5-12(6-4-11)14-15-13-7-8-27-17(13)19(25)23-16(15)18(21)24-20(14)26-2/h3-8,10H,9,22H2,1-2H3,(H,23,25) |
| InChIKey | FHNJGCMHUAOSGF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|