About 5-phenyl-1H-pyrazole
5-phenyl-1H-pyrazole (PubChem CID 17155) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 5-phenyl-1H-pyrazole.
Molecular Properties
| Compound Name | 5-phenyl-1H-pyrazole |
| PubChem CID | 17155 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 5-phenyl-1H-pyrazole |
| SMILES | c1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-7-10-11-9/h1-7H,(H,10,11) |
| InChIKey | OEDUIFSDODUDRK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-phenyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1H-pyrazole?
The IUPAC name of 5-phenyl-1H-pyrazole (CID 17155) is 5-phenyl-1H-pyrazole.
What is the SMILES notation for 5-phenyl-1H-pyrazole?
The canonical SMILES for 5-phenyl-1H-pyrazole is c1ccc(-c2ccn[nH]2)cc1.
What is the InChIKey of 5-phenyl-1H-pyrazole?
The InChIKey is OEDUIFSDODUDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-7-10-11-9/h1-7H,(H,10,11).
What are the key properties of 5-phenyl-1H-pyrazole?
5-phenyl-1H-pyrazole has a molecular weight of 144.18 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1H-pyrazole is sourced from PubChem (CID 17155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).