About 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane
3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane (PubChem CID 171550592) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane.
Molecular Properties
| Compound Name | 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane |
| PubChem CID | 171550592 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane |
| SMILES | CC.CC.CNC(=O)CCc1nc(C)cn1C |
| InChI | InChI=1S/C9H15N3O.2C2H6/c1-7-6-12(3)8(11-7)4-5-9(13)10-2;2*1-2/h6H,4-5H2,1-3H3,(H,10,13);2*1-2H3 |
| InChIKey | MUAGUUUISOVNJT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane?
The IUPAC name of 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane (CID 171550592) is 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane.
What is the SMILES notation for 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane?
The canonical SMILES for 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane is CC.CC.CNC(=O)CCc1nc(C)cn1C.
What is the InChIKey of 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane?
The InChIKey is MUAGUUUISOVNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O.2C2H6/c1-7-6-12(3)8(11-7)4-5-9(13)10-2;2*1-2/h6H,4-5H2,1-3H3,(H,10,13);2*1-2H3.
What are the key properties of 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane?
3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane has a molecular weight of 241.38 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dimethylimidazol-2-yl)-N-methylpropanamide;ethane is sourced from PubChem (CID 171550592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).