About 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane
1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane (PubChem CID 171550610) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane.
Molecular Properties
| Compound Name | 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane |
| PubChem CID | 171550610 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane |
| SMILES | C=C/C=C(/C)c1nc(C)cn1C.CC |
| InChI | InChI=1S/C10H14N2.C2H6/c1-5-6-8(2)10-11-9(3)7-12(10)4;1-2/h5-7H,1H2,2-4H3;1-2H3/b8-6-; |
| InChIKey | AUGYUZGDFLOPIJ-PHZXCRFESA-N |
| XLogP | 3.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane?
The IUPAC name of 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane (CID 171550610) is 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane.
What is the SMILES notation for 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane?
The canonical SMILES for 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane is C=C/C=C(/C)c1nc(C)cn1C.CC.
What is the InChIKey of 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane?
The InChIKey is AUGYUZGDFLOPIJ-PHZXCRFESA-N. The full InChI is InChI=1S/C10H14N2.C2H6/c1-5-6-8(2)10-11-9(3)7-12(10)4;1-2/h5-7H,1H2,2-4H3;1-2H3/b8-6-;.
What are the key properties of 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane?
1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane has a molecular weight of 192.31 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2-[(2Z)-penta-2,4-dien-2-yl]imidazole;ethane is sourced from PubChem (CID 171550610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).