C24H30F2N8O2 — CID 171550832
2-[4-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol (PubChem CID 171550832) has the molecular formula C24H30F2N8O2 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[4-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol.
| Compound Name | 2-[4-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol |
|---|---|
| PubChem CID | 171550832 |
| Molecular Formula | C24H30F2N8O2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2-[4-[[5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]cyclohexyl]oxyethanol |
| SMILES | CNc1nc(NC2CCC(OCCO)CC2)nn2ccc(-c3ccc4nc(C)n(CC(F)F)c4n3)c12 |
| InChI | InChI=1S/C24H30F2N8O2/c1-14-28-19-8-7-18(30-23(19)33(14)13-20(25)26)17-9-10-34-21(17)22(27-2)31-24(32-34)29-15-3-5-16(6-4-15)36-12-11-35/h7-10,15-16,20,35H,3-6,11-13H2,1-2H3,(H2,27,29,31,32) |
| InChIKey | IKCQXFSUZCCUFX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |