C21H24F2N8O — CID 171550874
4-[[4-amino-5-[3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 171550874) has the molecular formula C21H24F2N8O and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-[[4-amino-5-[3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[4-amino-5-[3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171550874 |
| Molecular Formula | C21H24F2N8O |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[[4-amino-5-[3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCC(Nc2nc(N)c3c(-c4ccc5ncn(CC(F)F)c5n4)ccn3n2)CC1 |
| InChI | InChI=1S/C21H24F2N8O/c1-21(32)7-4-12(5-8-21)26-20-28-18(24)17-13(6-9-31(17)29-20)14-2-3-15-19(27-14)30(11-25-15)10-16(22)23/h2-3,6,9,11-12,16,32H,4-5,7-8,10H2,1H3,(H3,24,26,28,29) |
| InChIKey | WCKXOSRZFBVUIX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |