C22H26F2N8O — CID 171550988
4-[[4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 171550988) has the molecular formula C22H26F2N8O and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-[[4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171550988 |
| Molecular Formula | C22H26F2N8O |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-[[4-amino-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | Cc1nc2ccc(-c3ccn4nc(NC5CCC(C)(O)CC5)nc(N)c34)nc2n1CC(F)F |
| InChI | InChI=1S/C22H26F2N8O/c1-12-26-16-4-3-15(28-20(16)31(12)11-17(23)24)14-7-10-32-18(14)19(25)29-21(30-32)27-13-5-8-22(2,33)9-6-13/h3-4,7,10,13,17,33H,5-6,8-9,11H2,1-2H3,(H3,25,27,29,30) |
| InChIKey | ATVQNWURDCOXCD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |