C22H33F3N8 — CID 171551148
1,1-difluoropropane;ethane;2-N-(2-fluoro-2-methylpropyl)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171551148) has the molecular formula C22H33F3N8 and a molecular weight of 466.56 g/mol. Its IUPAC name is 1,1-difluoropropane;ethane;2-N-(2-fluoro-2-methylpropyl)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 1,1-difluoropropane;ethane;2-N-(2-fluoro-2-methylpropyl)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171551148 |
| Molecular Formula | C22H33F3N8 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1,1-difluoropropane;ethane;2-N-(2-fluoro-2-methylpropyl)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | C/N=N/c1ccc(-c2ccn3nc(NCC(C)(C)F)nc(N)c23)nc1C.CC.CCC(F)F |
| InChI | InChI=1S/C17H21FN8.C3H6F2.C2H6/c1-10-12(24-20-4)5-6-13(22-10)11-7-8-26-14(11)15(19)23-16(25-26)21-9-17(2,3)18;1-2-3(4)5;1-2/h5-8H,9H2,1-4H3,(H3,19,21,23,25);3H,2H2,1H3;1-2H3/b24-20+;; |
| InChIKey | IQJXIKHYAYZYFJ-CNJXWVOHSA-N |
| XLogP | 6.24 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|