C26H30F2N8 — CID 171551428
2-N-(1-adamantyl)-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171551428) has the molecular formula C26H30F2N8 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-N-(1-adamantyl)-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 2-N-(1-adamantyl)-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171551428 |
| Molecular Formula | C26H30F2N8 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 2-N-(1-adamantyl)-5-[3-(2,2-difluoroethyl)-2-methylimidazo[4,5-b]pyridin-5-yl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CNc1nc(NC23CC4CC(CC(C4)C2)C3)nn2ccc(-c3ccc4nc(C)n(CC(F)F)c4n3)c12 |
| InChI | InChI=1S/C26H30F2N8/c1-14-30-20-4-3-19(31-24(20)35(14)13-21(27)28)18-5-6-36-22(18)23(29-2)32-25(34-36)33-26-10-15-7-16(11-26)9-17(8-15)12-26/h3-6,15-17,21H,7-13H2,1-2H3,(H2,29,32,33,34) |
| InChIKey | COSKDAFSMVKVDB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |