C25H38F2N8O — CID 171551567
1,1-difluoropropane;4-(dimethylamino)butanal;2-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171551567) has the molecular formula C25H38F2N8O and a molecular weight of 504.63 g/mol. Its IUPAC name is 1,1-difluoropropane;4-(dimethylamino)butanal;2-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 1,1-difluoropropane;4-(dimethylamino)butanal;2-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171551567 |
| Molecular Formula | C25H38F2N8O |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | 1,1-difluoropropane;4-(dimethylamino)butanal;2-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCC(F)F.CN(C)CCCC=O.CNc1nc(N)c2c(-c3ccc(N=C(C)C)c(C)n3)ccn2n1 |
| InChI | InChI=1S/C16H19N7.C6H13NO.C3H6F2/c1-9(2)19-12-5-6-13(20-10(12)3)11-7-8-23-14(11)15(17)21-16(18-4)22-23;1-7(2)5-3-4-6-8;1-2-3(4)5/h5-8H,1-4H3,(H3,17,18,21,22);6H,3-5H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YWVXHNQVSZVVMT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|