C22H25F3N8O — CID 171551683
4-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 171551683) has the molecular formula C22H25F3N8O and a molecular weight of 474.49 g/mol. Its IUPAC name is 4-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171551683 |
| Molecular Formula | C22H25F3N8O |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4-[[4-amino-5-[2-methyl-3-(2,2,2-trifluoroethyl)imidazo[4,5-b]pyridin-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | Cc1nc2ccc(-c3ccn4nc(NC5CCC(C)(O)CC5)nc(N)c34)nc2n1CC(F)(F)F |
| InChI | InChI=1S/C22H25F3N8O/c1-12-27-16-4-3-15(29-19(16)32(12)11-22(23,24)25)14-7-10-33-17(14)18(26)30-20(31-33)28-13-5-8-21(2,34)9-6-13/h3-4,7,10,13,34H,5-6,8-9,11H2,1-2H3,(H3,26,28,30,31) |
| InChIKey | LZZMPPFSEPQRPF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |