C21H25F2N9O — CID 171552001
4-[[5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 171552001) has the molecular formula C21H25F2N9O and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[[5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[[5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 171552001 |
| Molecular Formula | C21H25F2N9O |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 4-[[5-[3-(2,2-difluoroethyl)triazolo[4,5-b]pyridin-5-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CNc1nc(NC2CCC(C)(O)CC2)nn2ccc(-c3ccc4nnn(CC(F)F)c4n3)c12 |
| InChI | InChI=1S/C21H25F2N9O/c1-21(33)8-5-12(6-9-21)25-20-27-18(24-2)17-13(7-10-31(17)29-20)14-3-4-15-19(26-14)32(30-28-15)11-16(22)23/h3-4,7,10,12,16,33H,5-6,8-9,11H2,1-2H3,(H2,24,25,27,29) |
| InChIKey | AQRMUVMUFNZNHJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |