C19H23F2N9 — CID 171552277
1-ethyl-3,3-difluoropiperidine;5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171552277) has the molecular formula C19H23F2N9 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-ethyl-3,3-difluoropiperidine;5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 1-ethyl-3,3-difluoropiperidine;5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171552277 |
| Molecular Formula | C19H23F2N9 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-ethyl-3,3-difluoropiperidine;5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCN1CCCC(F)(F)C1.Nc1nc(N)c2c(-c3ccc4nccn4n3)ccn2n1 |
| InChI | InChI=1S/C12H10N8.C7H13F2N/c13-11-10-7(3-5-20(10)18-12(14)16-11)8-1-2-9-15-4-6-19(9)17-8;1-2-10-5-3-4-7(8,9)6-10/h1-6H,(H4,13,14,16,18);2-6H2,1H3 |
| InChIKey | GIFXTPRNRFPGPI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |