C17H19N5O — CID 171552367
11-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-8-one (PubChem CID 171552367) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 11-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 171552367 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 11-[(2E,4Z)-2-ethenylhepta-2,4,6-trienyl]-3,4,6,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-8-one |
| SMILES | C=C/C=C\C=C(/C=C)CN1CCc2c(c(=O)[nH]n3cnnc23)C1 |
| InChI | InChI=1S/C17H19N5O/c1-3-5-6-7-13(4-2)10-21-9-8-14-15(11-21)17(23)20-22-12-18-19-16(14)22/h3-7,12H,1-2,8-11H2,(H,20,23)/b6-5-,13-7+ |
| InChIKey | JJZFIUJJQFDXQI-RKOYKYSNSA-N |
| XLogP | 1.63 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|