C24H27F3N4O5S — CID 171552778
6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-3-methyl-N-(2,2,4-trimethyl-1,1-dioxothian-4-yl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 171552778) has the molecular formula C24H27F3N4O5S and a molecular weight of 540.56 g/mol. Its IUPAC name is 6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-3-methyl-N-(2,2,4-trimethyl-1,1-dioxothian-4-yl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-3-methyl-N-(2,2,4-trimethyl-1,1-dioxothian-4-yl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171552778 |
| Molecular Formula | C24H27F3N4O5S |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 6-[[3-(2,2-difluoroethoxy)-5-fluoro-2-pyridinyl]oxy]-3-methyl-N-(2,2,4-trimethyl-1,1-dioxothian-4-yl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2(C)CCS(=O)(=O)C(C)(C)C2)nc2ccc(Oc3ncc(F)cc3OCC(F)F)cn12 |
| InChI | InChI=1S/C24H27F3N4O5S/c1-14-20(21(32)30-24(4)7-8-37(33,34)23(2,3)13-24)29-19-6-5-16(11-31(14)19)36-22-17(35-12-18(26)27)9-15(25)10-28-22/h5-6,9-11,18H,7-8,12-13H2,1-4H3,(H,30,32) |
| InChIKey | NXVAEIDFLVSTSC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |