C23H24F4N4O5S — CID 171552793
N-(2,2-dimethyl-1,1-dioxothian-4-yl)-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3-methylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 171552793) has the molecular formula C23H24F4N4O5S and a molecular weight of 544.53 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,1-dioxothian-4-yl)-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3-methylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(2,2-dimethyl-1,1-dioxothian-4-yl)-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3-methylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171552793 |
| Molecular Formula | C23H24F4N4O5S |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | N-(2,2-dimethyl-1,1-dioxothian-4-yl)-6-[[5-fluoro-3-(2,2,2-trifluoroethoxy)-2-pyridinyl]oxy]-3-methylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCS(=O)(=O)C(C)(C)C2)nc2ccc(Oc3ncc(F)cc3OCC(F)(F)F)cn12 |
| InChI | InChI=1S/C23H24F4N4O5S/c1-13-19(20(32)29-15-6-7-37(33,34)22(2,3)9-15)30-18-5-4-16(11-31(13)18)36-21-17(8-14(24)10-28-21)35-12-23(25,26)27/h4-5,8,10-11,15H,6-7,9,12H2,1-3H3,(H,29,32) |
| InChIKey | AIIVQVQQBRDDFC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |