C11H15N3S — CID 17155303
3-imidazol-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 17155303) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 17155303 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-imidazol-1-yl-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | c1csc(CNCCCn2ccnc2)c1 |
| InChI | InChI=1S/C11H15N3S/c1-3-11(15-8-1)9-12-4-2-6-14-7-5-13-10-14/h1,3,5,7-8,10,12H,2,4,6,9H2 |
| InChIKey | IJQCIOLBJSGIEJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|