C21H21ClF3N5O5S — CID 171553050
6-[[5-chloro-3-(2,2-difluoroethoxy)-2-pyridinyl]oxy]-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 171553050) has the molecular formula C21H21ClF3N5O5S and a molecular weight of 547.94 g/mol. Its IUPAC name is 6-[[5-chloro-3-(2,2-difluoroethoxy)-2-pyridinyl]oxy]-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 6-[[5-chloro-3-(2,2-difluoroethoxy)-2-pyridinyl]oxy]-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171553050 |
| Molecular Formula | C21H21ClF3N5O5S |
| Molecular Weight | 547.94 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | 6-[[5-chloro-3-(2,2-difluoroethoxy)-2-pyridinyl]oxy]-8-fluoro-5-methyl-N-(4-methyl-1,1-dioxothian-4-yl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | Cc1c(Oc2ncc(Cl)cc2OCC(F)F)cc(F)c2nc(C(=O)NC3(C)CCS(=O)(=O)CC3)nn12 |
| InChI | InChI=1S/C21H21ClF3N5O5S/c1-11-14(35-20-15(34-10-16(24)25)7-12(22)9-26-20)8-13(23)18-27-17(29-30(11)18)19(31)28-21(2)3-5-36(32,33)6-4-21/h7-9,16H,3-6,10H2,1-2H3,(H,28,31) |
| InChIKey | AZSKCCCDVACQIW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |