C18H19F3N4O2 — CID 171553491
(3S,3aS,6aR)-1-[6-[2-hydroxy-4-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazin-3-yl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-ol (PubChem CID 171553491) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is (3S,3aS,6aR)-1-[6-[2-hydroxy-4-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazin-3-yl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-ol.
| Compound Name | (3S,3aS,6aR)-1-[6-[2-hydroxy-4-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazin-3-yl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-ol |
|---|---|
| PubChem CID | 171553491 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (3S,3aS,6aR)-1-[6-[2-hydroxy-4-(trifluoromethyl)phenyl]-5-methyl-1,2,4-triazin-3-yl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-3-ol |
| SMILES | Cc1nc(N2C[C@@H](O)[C@H]3CCC[C@H]32)nnc1-c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C18H19F3N4O2/c1-9-16(12-6-5-10(7-14(12)26)18(19,20)21)23-24-17(22-9)25-8-15(27)11-3-2-4-13(11)25/h5-7,11,13,15,26-27H,2-4,8H2,1H3/t11-,13+,15+/m0/s1 |
| InChIKey | RSBCFMQENUKBAE-NJZAAPMLSA-N |
| XLogP | 2.92 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |