About 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile
3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile (PubChem CID 171553631) has the molecular formula C18H16N4O2
and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile.
Molecular Properties
| Compound Name | 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile |
| PubChem CID | 171553631 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile |
| SMILES | [H]/N=C(/C(=O)N1CCOc2ccccc2C1)c1ccc(C#N)cc1N |
| InChI | InChI=1S/C18H16N4O2/c19-10-12-5-6-14(15(20)9-12)17(21)18(23)22-7-8-24-16-4-2-1-3-13(16)11-22/h1-6,9,21H,7-8,11,20H2/b21-17+ |
| InChIKey | MSTXAFYNWVKXGY-HEHNFIMWSA-N |
| XLogP | 1.93 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile?
The IUPAC name of 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile (CID 171553631) is 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile.
What is the SMILES notation for 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile?
The canonical SMILES for 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile is [H]/N=C(/C(=O)N1CCOc2ccccc2C1)c1ccc(C#N)cc1N.
What is the InChIKey of 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile?
The InChIKey is MSTXAFYNWVKXGY-HEHNFIMWSA-N. The full InChI is InChI=1S/C18H16N4O2/c19-10-12-5-6-14(15(20)9-12)17(21)18(23)22-7-8-24-16-4-2-1-3-13(16)11-22/h1-6,9,21H,7-8,11,20H2/b21-17+.
What are the key properties of 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile?
3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile has a molecular weight of 320.35 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)-2-oxoethanimidoyl]benzonitrile is sourced from PubChem (CID 171553631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).