C16H18N4O2 — CID 171553668
3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-(6-methyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone (PubChem CID 171553668) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-(6-methyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone.
| Compound Name | 3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-(6-methyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 171553668 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3,5-dihydro-2H-pyrido[3,4-f][1,4]oxazepin-4-yl-(6-methyl-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone |
| SMILES | CC1CCc2c(C(=O)N3CCOc4ccncc4C3)n[nH]c21 |
| InChI | InChI=1S/C16H18N4O2/c1-10-2-3-12-14(10)18-19-15(12)16(21)20-6-7-22-13-4-5-17-8-11(13)9-20/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,18,19) |
| InChIKey | OIUAUQRHORQXTA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |