About dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate
dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate (PubChem CID 171554286) has the molecular formula C25H24N4O4
and a molecular weight of 444.49 g/mol. Its IUPAC name is dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate |
| PubChem CID | 171554286 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1cccc(Nc2cc3c(C)nn(C)c3cc2-c2ccnc(C)c2)c1C(=O)OC |
| InChI | InChI=1S/C25H24N4O4/c1-14-11-16(9-10-26-14)19-13-22-18(15(2)28-29(22)3)12-21(19)27-20-8-6-7-17(24(30)32-4)23(20)25(31)33-5/h6-13,27H,1-5H3 |
| InChIKey | CYDVISBXEULKOF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate?
The IUPAC name of dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate (CID 171554286) is dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate?
The canonical SMILES for dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate is COC(=O)c1cccc(Nc2cc3c(C)nn(C)c3cc2-c2ccnc(C)c2)c1C(=O)OC.
What is the InChIKey of dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate?
The InChIKey is CYDVISBXEULKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N4O4/c1-14-11-16(9-10-26-14)19-13-22-18(15(2)28-29(22)3)12-21(19)27-20-8-6-7-17(24(30)32-4)23(20)25(31)33-5/h6-13,27H,1-5H3.
What are the key properties of dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate?
dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate has a molecular weight of 444.49 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-[[1,3-dimethyl-6-(2-methyl-4-pyridinyl)indazol-5-yl]amino]benzene-1,2-dicarboxylate is sourced from PubChem (CID 171554286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).