C28H20F3N5O4 — CID 171554306
2-(2,6-dioxopiperidin-3-yl)-4-[[1-methyl-6-[3-(trifluoromethyl)phenyl]indazol-5-yl]amino]isoindole-1,3-dione (PubChem CID 171554306) has the molecular formula C28H20F3N5O4 and a molecular weight of 547.49 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[1-methyl-6-[3-(trifluoromethyl)phenyl]indazol-5-yl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[1-methyl-6-[3-(trifluoromethyl)phenyl]indazol-5-yl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171554306 |
| Molecular Formula | C28H20F3N5O4 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[1-methyl-6-[3-(trifluoromethyl)phenyl]indazol-5-yl]amino]isoindole-1,3-dione |
| SMILES | Cn1ncc2cc(Nc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)c(-c3cccc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C28H20F3N5O4/c1-35-22-12-18(14-4-2-5-16(10-14)28(29,30)31)20(11-15(22)13-32-35)33-19-7-3-6-17-24(19)27(40)36(26(17)39)21-8-9-23(37)34-25(21)38/h2-7,10-13,21,33H,8-9H2,1H3,(H,34,37,38) |
| InChIKey | CQOHUZGUJWLVGR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|