C20H23N3O — CID 171555060
N-[7-[(2E,4Z)-4-methyl-6-methylidenenona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]formamide (PubChem CID 171555060) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[7-[(2E,4Z)-4-methyl-6-methylidenenona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]formamide.
| Compound Name | N-[7-[(2E,4Z)-4-methyl-6-methylidenenona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]formamide |
|---|---|
| PubChem CID | 171555060 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-[7-[(2E,4Z)-4-methyl-6-methylidenenona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]formamide |
| SMILES | C=C(/C=C(C)\C(=C/C)c1cc2cnc(NC=O)cc2cn1)CCC |
| InChI | InChI=1S/C20H23N3O/c1-5-7-14(3)8-15(4)18(6-2)19-9-16-12-22-20(23-13-24)10-17(16)11-21-19/h6,8-13H,3,5,7H2,1-2,4H3,(H,22,23,24)/b15-8-,18-6+ |
| InChIKey | NCOSPJOTTZURKQ-DSEHZFEJSA-N |
| XLogP | 4.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|