C23H31N3O — CID 171555969
(5Z,6Z,8E)-8-(7-amino-2,6-naphthyridin-3-yl)-5-butan-2-ylidene-7-methyldeca-6,8-dien-4-ol (PubChem CID 171555969) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is (5Z,6Z,8E)-8-(7-amino-2,6-naphthyridin-3-yl)-5-butan-2-ylidene-7-methyldeca-6,8-dien-4-ol.
| Compound Name | (5Z,6Z,8E)-8-(7-amino-2,6-naphthyridin-3-yl)-5-butan-2-ylidene-7-methyldeca-6,8-dien-4-ol |
|---|---|
| PubChem CID | 171555969 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (5Z,6Z,8E)-8-(7-amino-2,6-naphthyridin-3-yl)-5-butan-2-ylidene-7-methyldeca-6,8-dien-4-ol |
| SMILES | C/C=C(C(\C)=C/C(=C(\C)CC)C(O)CCC)/c1cc2cnc(N)cc2cn1 |
| InChI | InChI=1S/C23H31N3O/c1-6-9-22(27)20(15(4)7-2)10-16(5)19(8-3)21-11-17-14-26-23(24)12-18(17)13-25-21/h8,10-14,22,27H,6-7,9H2,1-5H3,(H2,24,26)/b16-10-,19-8+,20-15- |
| InChIKey | AOFUNITXJISJET-DJAWXTSJSA-N |
| XLogP | 5.45 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|