C11H12ClN3 — CID 171556036
(4E,5E)-5-(2-chloroprop-2-enylidene)-4-ethylidene-3-methanimidoylpyridin-2-amine (PubChem CID 171556036) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is (4E,5E)-5-(2-chloroprop-2-enylidene)-4-ethylidene-3-methanimidoylpyridin-2-amine.
| Compound Name | (4E,5E)-5-(2-chloroprop-2-enylidene)-4-ethylidene-3-methanimidoylpyridin-2-amine |
|---|---|
| PubChem CID | 171556036 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (4E,5E)-5-(2-chloroprop-2-enylidene)-4-ethylidene-3-methanimidoylpyridin-2-amine |
| SMILES | [H]/N=C/c1c(N)ncc(=C/C(=C)Cl)/c1=C\C |
| InChI | InChI=1S/C11H12ClN3/c1-3-9-8(4-7(2)12)6-15-11(14)10(9)5-13/h3-6,13H,2,14H2,1H3/b8-4-,9-3+,13-5+ |
| InChIKey | BZNPKTOKYGQJBD-PLKDGDDCSA-N |
| XLogP | 0.99 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|